C15H11ClF8O3 — CID 121484902
ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,5,5,5-pentafluoro-3-oxopentanoate (PubChem CID 121484902) has the molecular formula C15H11ClF8O3 and a molecular weight of 426.69 g/mol. Its IUPAC name is ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,5,5,5-pentafluoro-3-oxopentanoate.
| Compound Name | ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,5,5,5-pentafluoro-3-oxopentanoate |
|---|---|
| PubChem CID | 121484902 |
| Molecular Formula | C15H11ClF8O3 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | ethyl 2-[[4-chloro-3-(trifluoromethyl)phenyl]methyl]-4,4,5,5,5-pentafluoro-3-oxopentanoate |
| SMILES | CCOC(=O)C(Cc1ccc(Cl)c(C(F)(F)F)c1)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H11ClF8O3/c1-2-27-12(26)8(11(25)13(17,18)15(22,23)24)5-7-3-4-10(16)9(6-7)14(19,20)21/h3-4,6,8H,2,5H2,1H3 |
| InChIKey | ZSKQYJVTYSKJOU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|