C12H13ClF3NO2 — CID 146169728
ethyl (1Z)-N-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]ethanimidate (PubChem CID 146169728) has the molecular formula C12H13ClF3NO2 and a molecular weight of 295.69 g/mol. Its IUPAC name is ethyl (1Z)-N-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]ethanimidate.
| Compound Name | ethyl (1Z)-N-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]ethanimidate |
|---|---|
| PubChem CID | 146169728 |
| Molecular Formula | C12H13ClF3NO2 |
| Molecular Weight | 295.69 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | ethyl (1Z)-N-[[4-chloro-3-(trifluoromethyl)phenyl]methoxy]ethanimidate |
| SMILES | CCO/C(C)=N\OCc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C12H13ClF3NO2/c1-3-18-8(2)17-19-7-9-4-5-11(13)10(6-9)12(14,15)16/h4-6H,3,7H2,1-2H3/b17-8- |
| InChIKey | KHYLROCBDIQUGK-IUXPMGMMSA-N |
| XLogP | 4.25 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.69 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|