C15H15F3O4 — CID 10615301
ethyl 2-[(4-acetylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 10615301) has the molecular formula C15H15F3O4 and a molecular weight of 316.28 g/mol. Its IUPAC name is ethyl 2-[(4-acetylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-[(4-acetylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 10615301 |
| Molecular Formula | C15H15F3O4 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | ethyl 2-[(4-acetylphenyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(Cc1ccc(C(C)=O)cc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C15H15F3O4/c1-3-22-14(21)12(13(20)15(16,17)18)8-10-4-6-11(7-5-10)9(2)19/h4-7,12H,3,8H2,1-2H3 |
| InChIKey | ANPQJCCPZRPUAE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|