C12H11ClF3NO3 — CID 125492004
ethyl (2R)-2-[(6-chloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 125492004) has the molecular formula C12H11ClF3NO3 and a molecular weight of 309.67 g/mol. Its IUPAC name is ethyl (2R)-2-[(6-chloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl (2R)-2-[(6-chloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 125492004 |
| Molecular Formula | C12H11ClF3NO3 |
| Molecular Weight | 309.67 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | ethyl (2R)-2-[(6-chloro-3-pyridinyl)methyl]-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)[C@H](Cc1ccc(Cl)nc1)C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11ClF3NO3/c1-2-20-11(19)8(10(18)12(14,15)16)5-7-3-4-9(13)17-6-7/h3-4,6,8H,2,5H2,1H3/t8-/m1/s1 |
| InChIKey | VUKKBIMMGMIURO-MRVPVSSYSA-N |
| XLogP | 2.59 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.67 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|