C7H8ClF3O3 — CID 171780439
ethyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate (PubChem CID 171780439) has the molecular formula C7H8ClF3O3 and a molecular weight of 232.58 g/mol. Its IUPAC name is ethyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate.
| Compound Name | ethyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate |
|---|---|
| PubChem CID | 171780439 |
| Molecular Formula | C7H8ClF3O3 |
| Molecular Weight | 232.58 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | ethyl 2-(chloromethyl)-4,4,4-trifluoro-3-oxobutanoate |
| SMILES | CCOC(=O)C(CCl)C(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8ClF3O3/c1-2-14-6(13)4(3-8)5(12)7(9,10)11/h4H,2-3H2,1H3 |
| InChIKey | CKGACPXKHABGKZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|