C8H11F3O3 — CID 11042055
methyl 2-(2,2,2-trifluoroacetyl)pentanoate (PubChem CID 11042055) has the molecular formula C8H11F3O3 and a molecular weight of 212.17 g/mol. Its IUPAC name is methyl 2-(2,2,2-trifluoroacetyl)pentanoate.
| Compound Name | methyl 2-(2,2,2-trifluoroacetyl)pentanoate |
|---|---|
| PubChem CID | 11042055 |
| Molecular Formula | C8H11F3O3 |
| Molecular Weight | 212.17 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | methyl 2-(2,2,2-trifluoroacetyl)pentanoate |
| SMILES | CCCC(C(=O)OC)C(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F3O3/c1-3-4-5(7(13)14-2)6(12)8(9,10)11/h5H,3-4H2,1-2H3 |
| InChIKey | XJUPRWAHFXNXDW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.17 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|