C9H11F5O4 — CID 139808891
dimethyl 2-(3,3,4,4,4-pentafluorobutyl)propanedioate (PubChem CID 139808891) has the molecular formula C9H11F5O4 and a molecular weight of 278.17 g/mol. Its IUPAC name is dimethyl 2-(3,3,4,4,4-pentafluorobutyl)propanedioate.
| Compound Name | dimethyl 2-(3,3,4,4,4-pentafluorobutyl)propanedioate |
|---|---|
| PubChem CID | 139808891 |
| Molecular Formula | C9H11F5O4 |
| Molecular Weight | 278.17 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | dimethyl 2-(3,3,4,4,4-pentafluorobutyl)propanedioate |
| SMILES | COC(=O)C(CCC(F)(F)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H11F5O4/c1-17-6(15)5(7(16)18-2)3-4-8(10,11)9(12,13)14/h5H,3-4H2,1-2H3 |
| InChIKey | RFSQYUJAPIUADH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.17 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|