C11H20O3 — CID 18370318
methyl 2-acetyl-5,5-dimethylhexanoate (PubChem CID 18370318) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is methyl 2-acetyl-5,5-dimethylhexanoate.
| Compound Name | methyl 2-acetyl-5,5-dimethylhexanoate |
|---|---|
| PubChem CID | 18370318 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | methyl 2-acetyl-5,5-dimethylhexanoate |
| SMILES | COC(=O)C(CCC(C)(C)C)C(C)=O |
| InChI | InChI=1S/C11H20O3/c1-8(12)9(10(13)14-5)6-7-11(2,3)4/h9H,6-7H2,1-5H3 |
| InChIKey | XMKLDRBSQAGZMM-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|