About methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate
methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate (PubChem CID 167496461) has the molecular formula C10H17F3O5S
and a molecular weight of 306.30 g/mol. Its IUPAC name is methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate.
Molecular Properties
| Compound Name | methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate |
| PubChem CID | 167496461 |
| Molecular Formula | C10H17F3O5S |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate |
| SMILES | COC(=O)[C@@H](CCC(C)(C)C)OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O5S/c1-9(2,3)6-5-7(8(14)17-4)18-19(15,16)10(11,12)13/h7H,5-6H2,1-4H3/t7-/m1/s1 |
| InChIKey | RSHWGBSUDFCITM-SSDOTTSWSA-N |
| XLogP | 2.22 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate?
The IUPAC name of methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate (CID 167496461) is methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate.
What is the SMILES notation for methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate?
The canonical SMILES for methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate is COC(=O)[C@@H](CCC(C)(C)C)OS(=O)(=O)C(F)(F)F.
What is the InChIKey of methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate?
The InChIKey is RSHWGBSUDFCITM-SSDOTTSWSA-N. The full InChI is InChI=1S/C10H17F3O5S/c1-9(2,3)6-5-7(8(14)17-4)18-19(15,16)10(11,12)13/h7H,5-6H2,1-4H3/t7-/m1/s1.
What are the key properties of methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate?
methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate has a molecular weight of 306.30 g/mol, XLogP of 2.22, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R)-5,5-dimethyl-2-(trifluoromethylsulfonyloxy)hexanoate is sourced from PubChem (CID 167496461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).