C5H7F3O5S — CID 87372021
(2R)-2-(trifluoromethylsulfonyloxy)butanoic acid (PubChem CID 87372021) has the molecular formula C5H7F3O5S and a molecular weight of 236.17 g/mol. Its IUPAC name is (2R)-2-(trifluoromethylsulfonyloxy)butanoic acid.
| Compound Name | (2R)-2-(trifluoromethylsulfonyloxy)butanoic acid |
|---|---|
| PubChem CID | 87372021 |
| Molecular Formula | C5H7F3O5S |
| Molecular Weight | 236.17 g/mol |
| Exact Mass | 236.00 |
| IUPAC Name | (2R)-2-(trifluoromethylsulfonyloxy)butanoic acid |
| SMILES | CC[C@@H](OS(=O)(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C5H7F3O5S/c1-2-3(4(9)10)13-14(11,12)5(6,7)8/h3H,2H2,1H3,(H,9,10)/t3-/m1/s1 |
| InChIKey | TYIVNXBLBLQIOI-GSVOUGTGSA-N |
| XLogP | 0.72 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.17 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|