C12H11F3O7S — CID 58900342
3-(4-acetyloxyphenyl)-2-(trifluoromethylsulfonyloxy)propanoic acid (PubChem CID 58900342) has the molecular formula C12H11F3O7S and a molecular weight of 356.27 g/mol. Its IUPAC name is 3-(4-acetyloxyphenyl)-2-(trifluoromethylsulfonyloxy)propanoic acid.
| Compound Name | 3-(4-acetyloxyphenyl)-2-(trifluoromethylsulfonyloxy)propanoic acid |
|---|---|
| PubChem CID | 58900342 |
| Molecular Formula | C12H11F3O7S |
| Molecular Weight | 356.27 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 3-(4-acetyloxyphenyl)-2-(trifluoromethylsulfonyloxy)propanoic acid |
| SMILES | CC(=O)Oc1ccc(CC(OS(=O)(=O)C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C12H11F3O7S/c1-7(16)21-9-4-2-8(3-5-9)6-10(11(17)18)22-23(19,20)12(13,14)15/h2-5,10H,6H2,1H3,(H,17,18) |
| InChIKey | OAEGHFHEXWAJBG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|