C16H24O8S — CID 172811551
3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoic acid (PubChem CID 172811551) has the molecular formula C16H24O8S and a molecular weight of 376.43 g/mol. Its IUPAC name is 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoic acid.
| Compound Name | 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoic acid |
|---|---|
| PubChem CID | 172811551 |
| Molecular Formula | C16H24O8S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoic acid |
| SMILES | CCOCCOCCOc1ccc(CC(OS(C)(=O)=O)C(=O)O)cc1 |
| InChI | InChI=1S/C16H24O8S/c1-3-21-8-9-22-10-11-23-14-6-4-13(5-7-14)12-15(16(17)18)24-25(2,19)20/h4-7,15H,3,8-12H2,1-2H3,(H,17,18) |
| InChIKey | SFZOFILBGDZOTR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|