C23H40N4O5 — CID 172852564
(2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-(1,4,7,10-tetrazacyclododec-1-yl)propanoic acid (PubChem CID 172852564) has the molecular formula C23H40N4O5 and a molecular weight of 452.60 g/mol. Its IUPAC name is (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-(1,4,7,10-tetrazacyclododec-1-yl)propanoic acid.
| Compound Name | (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-(1,4,7,10-tetrazacyclododec-1-yl)propanoic acid |
|---|---|
| PubChem CID | 172852564 |
| Molecular Formula | C23H40N4O5 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-(1,4,7,10-tetrazacyclododec-1-yl)propanoic acid |
| SMILES | CCOCCOCCOc1ccc(C[C@H](C(=O)O)N2CCNCCNCCNCC2)cc1 |
| InChI | InChI=1S/C23H40N4O5/c1-2-30-15-16-31-17-18-32-21-5-3-20(4-6-21)19-22(23(28)29)27-13-11-25-9-7-24-8-10-26-12-14-27/h3-6,22,24-26H,2,7-19H2,1H3,(H,28,29)/t22-/m1/s1 |
| InChIKey | YGMDEKOZQPRHKV-JOCHJYFZSA-N |
| XLogP | 0.20 |
| TPSA | 104.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|