C29H46N4O9 — CID 174275582
3-(4-propoxyphenyl)-2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid (PubChem CID 174275582) has the molecular formula C29H46N4O9 and a molecular weight of 594.71 g/mol. Its IUPAC name is 3-(4-propoxyphenyl)-2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid.
| Compound Name | 3-(4-propoxyphenyl)-2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid |
|---|---|
| PubChem CID | 174275582 |
| Molecular Formula | C29H46N4O9 |
| Molecular Weight | 594.71 g/mol |
| Exact Mass | 594.33 |
| IUPAC Name | 3-(4-propoxyphenyl)-2-[4,7,10-tris(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid |
| SMILES | CCCOc1ccc(CC(C(=O)O)N2CCN(CC(=O)OC)CCN(CC(=O)OC)CCN(CC(=O)OC)CC2)cc1 |
| InChI | InChI=1S/C29H46N4O9/c1-5-18-42-24-8-6-23(7-9-24)19-25(29(37)38)33-16-14-31(21-27(35)40-3)12-10-30(20-26(34)39-2)11-13-32(15-17-33)22-28(36)41-4/h6-9,25H,5,10-22H2,1-4H3,(H,37,38) |
| InChIKey | RAROLGDJHCWSQY-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 138.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.71 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|