C25H32F3GdN4O9 — CID 174172196
2-[4,10-bis(carboxylatomethyl)-7-[(1R)-1-carboxy-2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) (PubChem CID 174172196) has the molecular formula C25H32F3GdN4O9 and a molecular weight of 746.79 g/mol. Its IUPAC name is 2-[4,10-bis(carboxylatomethyl)-7-[(1R)-1-carboxy-2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+).
| Compound Name | 2-[4,10-bis(carboxylatomethyl)-7-[(1R)-1-carboxy-2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
|---|---|
| PubChem CID | 174172196 |
| Molecular Formula | C25H32F3GdN4O9 |
| Molecular Weight | 746.79 g/mol |
| Exact Mass | 747.14 |
| IUPAC Name | 2-[4,10-bis(carboxylatomethyl)-7-[(1R)-1-carboxy-2-[4-(2,2,2-trifluoroethoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]acetate;gadolinium(3+) |
| SMILES | O=C([O-])CN1CCN(CC(=O)[O-])CCN([C@H](Cc2ccc(OCC(F)(F)F)cc2)C(=O)O)CCN(CC(=O)[O-])CC1.[Gd+3] |
| InChI | InChI=1S/C25H35F3N4O9.Gd/c26-25(27,28)17-41-19-3-1-18(2-4-19)13-20(24(39)40)32-11-9-30(15-22(35)36)7-5-29(14-21(33)34)6-8-31(10-12-32)16-23(37)38;/h1-4,20H,5-17H2,(H,33,34)(H,35,36)(H,37,38)(H,39,40);/q;+3/p-3/t20-;/m1./s1 |
| InChIKey | OMARWXRKYDHOED-VEIFNGETSA-K |
| XLogP | -3.91 |
| TPSA | 179.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.79 |
| LogP ≤ 5 | -3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |