C28H40F4N4O10 — CID 171065576
2-[7-[(1S)-1-carboxy-2-hydroxyethyl]-4-(carboxymethyl)-10-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]propanoic acid (PubChem CID 171065576) has the molecular formula C28H40F4N4O10 and a molecular weight of 668.64 g/mol. Its IUPAC name is 2-[7-[(1S)-1-carboxy-2-hydroxyethyl]-4-(carboxymethyl)-10-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]propanoic acid.
| Compound Name | 2-[7-[(1S)-1-carboxy-2-hydroxyethyl]-4-(carboxymethyl)-10-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]propanoic acid |
|---|---|
| PubChem CID | 171065576 |
| Molecular Formula | C28H40F4N4O10 |
| Molecular Weight | 668.64 g/mol |
| Exact Mass | 668.27 |
| IUPAC Name | 2-[7-[(1S)-1-carboxy-2-hydroxyethyl]-4-(carboxymethyl)-10-(2-methoxy-2-oxoethyl)-1,4,7,10-tetrazacyclododec-1-yl]-3-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]propanoic acid |
| SMILES | COC(=O)CN1CCN(C(Cc2ccc(OCC(F)(F)C(F)F)cc2)C(=O)O)CCN(CC(=O)O)CCN([C@@H](CO)C(=O)O)CC1 |
| InChI | InChI=1S/C28H40F4N4O10/c1-45-24(40)16-34-8-11-35(10-6-33(15-23(38)39)7-12-36(13-9-34)22(17-37)26(43)44)21(25(41)42)14-19-2-4-20(5-3-19)46-18-28(31,32)27(29)30/h2-5,21-22,27,37H,6-18H2,1H3,(H,38,39)(H,41,42)(H,43,44)/t21?,22-/m0/s1 |
| InChIKey | JIROZWPQFGQCQO-KEKNWZKVSA-N |
| XLogP | -0.11 |
| TPSA | 180.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.64 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|