C28H38F4N4O10-2 — CID 171065645
2-[4-(carboxylatomethyl)-10-(carboxymethyl)-7-[1-carboxy-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-methoxypropanoate (PubChem CID 171065645) has the molecular formula C28H38F4N4O10-2 and a molecular weight of 666.62 g/mol. Its IUPAC name is 2-[4-(carboxylatomethyl)-10-(carboxymethyl)-7-[1-carboxy-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-methoxypropanoate.
| Compound Name | 2-[4-(carboxylatomethyl)-10-(carboxymethyl)-7-[1-carboxy-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-methoxypropanoate |
|---|---|
| PubChem CID | 171065645 |
| Molecular Formula | C28H38F4N4O10-2 |
| Molecular Weight | 666.62 g/mol |
| Exact Mass | 666.25 |
| IUPAC Name | 2-[4-(carboxylatomethyl)-10-(carboxymethyl)-7-[1-carboxy-2-[4-(2,2,3,3-tetrafluoropropoxy)phenyl]ethyl]-1,4,7,10-tetrazacyclododec-1-yl]-3-methoxypropanoate |
| SMILES | COCC(C(=O)[O-])N1CCN(CC(=O)[O-])CCN(C(Cc2ccc(OCC(F)(F)C(F)F)cc2)C(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C28H40F4N4O10/c1-45-17-22(26(43)44)36-12-8-33(15-23(37)38)6-10-35(11-7-34(9-13-36)16-24(39)40)21(25(41)42)14-19-2-4-20(5-3-19)46-18-28(31,32)27(29)30/h2-5,21-22,27H,6-18H2,1H3,(H,37,38)(H,39,40)(H,41,42)(H,43,44)/p-2 |
| InChIKey | AEAIDGSKBMWVSK-UHFFFAOYSA-L |
| XLogP | -2.22 |
| TPSA | 186.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.62 |
| LogP ≤ 5 | -2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|