C32H52GdN4O14 — CID 170648024
3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris(1-carboxy-2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid;gadolinium (PubChem CID 170648024) has the molecular formula C32H52GdN4O14 and a molecular weight of 874.03 g/mol. Its IUPAC name is 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris(1-carboxy-2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid;gadolinium.
| Compound Name | 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris(1-carboxy-2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid;gadolinium |
|---|---|
| PubChem CID | 170648024 |
| Molecular Formula | C32H52GdN4O14 |
| Molecular Weight | 874.03 g/mol |
| Exact Mass | 874.27 |
| IUPAC Name | 3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-[4,7,10-tris(1-carboxy-2-hydroxyethyl)-1,4,7,10-tetrazacyclododec-1-yl]propanoic acid;gadolinium |
| SMILES | CCOCCOCCOc1ccc(CC(C(=O)O)N2CCN(C(CO)C(=O)O)CCN(C(CO)C(=O)O)CCN(C(CO)C(=O)O)CC2)cc1.[Gd] |
| InChI | InChI=1S/C32H52N4O14.Gd/c1-2-48-15-16-49-17-18-50-24-5-3-23(4-6-24)19-25(29(40)41)33-7-9-34(26(20-37)30(42)43)11-13-36(28(22-39)32(46)47)14-12-35(10-8-33)27(21-38)31(44)45;/h3-6,25-28,37-39H,2,7-22H2,1H3,(H,40,41)(H,42,43)(H,44,45)(H,46,47); |
| InChIKey | IBMYHWDBYFSLPK-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 250.54 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 874.03 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|