C20H32O8S — CID 165125455
tert-butyl (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoate (PubChem CID 165125455) has the molecular formula C20H32O8S and a molecular weight of 432.54 g/mol. Its IUPAC name is tert-butyl (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoate.
| Compound Name | tert-butyl (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoate |
|---|---|
| PubChem CID | 165125455 |
| Molecular Formula | C20H32O8S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.18 |
| IUPAC Name | tert-butyl (2R)-3-[4-[2-(2-ethoxyethoxy)ethoxy]phenyl]-2-methylsulfonyloxypropanoate |
| SMILES | CCOCCOCCOc1ccc(C[C@@H](OS(C)(=O)=O)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C20H32O8S/c1-6-24-11-12-25-13-14-26-17-9-7-16(8-10-17)15-18(28-29(5,22)23)19(21)27-20(2,3)4/h7-10,18H,6,11-15H2,1-5H3/t18-/m1/s1 |
| InChIKey | GORPNYWMKLJVFY-GOSISDBHSA-N |
| XLogP | 2.35 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|