C20H25NO6S — CID 139710446
ethyl 2-methylsulfonyloxy-3-[4-(3-pyridin-3-ylpropoxy)phenyl]propanoate (PubChem CID 139710446) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is ethyl 2-methylsulfonyloxy-3-[4-(3-pyridin-3-ylpropoxy)phenyl]propanoate.
| Compound Name | ethyl 2-methylsulfonyloxy-3-[4-(3-pyridin-3-ylpropoxy)phenyl]propanoate |
|---|---|
| PubChem CID | 139710446 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | ethyl 2-methylsulfonyloxy-3-[4-(3-pyridin-3-ylpropoxy)phenyl]propanoate |
| SMILES | CCOC(=O)C(Cc1ccc(OCCCc2cccnc2)cc1)OS(C)(=O)=O |
| InChI | InChI=1S/C20H25NO6S/c1-3-25-20(22)19(27-28(2,23)24)14-16-8-10-18(11-9-16)26-13-5-7-17-6-4-12-21-15-17/h4,6,8-12,15,19H,3,5,7,13-14H2,1-2H3 |
| InChIKey | ZOWARZBKVZAXAX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|