C27H30N4O4 — CID 11134544
N-(2-amino-2-oxoethyl)-2-[[2-(4-methylphenyl)acetyl]amino]-2-[4-(3-pyridin-3-ylpropoxy)phenyl]acetamide (PubChem CID 11134544) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-[[2-(4-methylphenyl)acetyl]amino]-2-[4-(3-pyridin-3-ylpropoxy)phenyl]acetamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-[[2-(4-methylphenyl)acetyl]amino]-2-[4-(3-pyridin-3-ylpropoxy)phenyl]acetamide |
|---|---|
| PubChem CID | 11134544 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-[[2-(4-methylphenyl)acetyl]amino]-2-[4-(3-pyridin-3-ylpropoxy)phenyl]acetamide |
| SMILES | Cc1ccc(CC(=O)NC(C(=O)NCC(N)=O)c2ccc(OCCCc3cccnc3)cc2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-19-6-8-20(9-7-19)16-25(33)31-26(27(34)30-18-24(28)32)22-10-12-23(13-11-22)35-15-3-5-21-4-2-14-29-17-21/h2,4,6-14,17,26H,3,5,15-16,18H2,1H3,(H2,28,32)(H,30,34)(H,31,33) |
| InChIKey | LATBQUYQTDAWKY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 123.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|