C21H27NO2 — CID 124528117
3-pyridin-3-ylpropyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate (PubChem CID 124528117) has the molecular formula C21H27NO2 and a molecular weight of 325.45 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate.
| Compound Name | 3-pyridin-3-ylpropyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
|---|---|
| PubChem CID | 124528117 |
| Molecular Formula | C21H27NO2 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.20 |
| IUPAC Name | 3-pyridin-3-ylpropyl (2S)-2-[4-(2-methylpropyl)phenyl]propanoate |
| SMILES | CC(C)Cc1ccc([C@H](C)C(=O)OCCCc2cccnc2)cc1 |
| InChI | InChI=1S/C21H27NO2/c1-16(2)14-18-8-10-20(11-9-18)17(3)21(23)24-13-5-7-19-6-4-12-22-15-19/h4,6,8-12,15-17H,5,7,13-14H2,1-3H3/t17-/m0/s1 |
| InChIKey | WMMFROBWCNGSLE-KRWDZBQOSA-N |
| XLogP | 4.56 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|