C12H17NO2S — CID 88778268
3-pyridin-3-ylpropyl 2-sulfanylbutanoate (PubChem CID 88778268) has the molecular formula C12H17NO2S and a molecular weight of 239.34 g/mol. Its IUPAC name is 3-pyridin-3-ylpropyl 2-sulfanylbutanoate.
| Compound Name | 3-pyridin-3-ylpropyl 2-sulfanylbutanoate |
|---|---|
| PubChem CID | 88778268 |
| Molecular Formula | C12H17NO2S |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.10 |
| IUPAC Name | 3-pyridin-3-ylpropyl 2-sulfanylbutanoate |
| SMILES | CCC(S)C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C12H17NO2S/c1-2-11(16)12(14)15-8-4-6-10-5-3-7-13-9-10/h3,5,7,9,11,16H,2,4,6,8H2,1H3 |
| InChIKey | NNOWYFSXBPZUCG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 39.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|