C28H35N3O4 — CID 67694201
bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-propyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67694201) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-propyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-propyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67694201 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-propyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CCCC1C(C(=O)OCCCc2cccnc2)=C(C)NC(C)=C1C(=O)OCCCc1cccnc1 |
| InChI | InChI=1S/C28H35N3O4/c1-4-9-24-25(27(32)34-16-7-12-22-10-5-14-29-18-22)20(2)31-21(3)26(24)28(33)35-17-8-13-23-11-6-15-30-19-23/h5-6,10-11,14-15,18-19,24,31H,4,7-9,12-13,16-17H2,1-3H3 |
| InChIKey | CERHRDWGIVIMMZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|