C33H37N3O4 — CID 67694112
bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-(1-phenylethyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67694112) has the molecular formula C33H37N3O4 and a molecular weight of 539.68 g/mol. Its IUPAC name is bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-(1-phenylethyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-(1-phenylethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67694112 |
| Molecular Formula | C33H37N3O4 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.28 |
| IUPAC Name | bis(3-pyridin-3-ylpropyl) 2,6-dimethyl-4-(1-phenylethyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCc2cccnc2)C(C(C)c2ccccc2)C(C(=O)OCCCc2cccnc2)=C(C)N1 |
| InChI | InChI=1S/C33H37N3O4/c1-23(28-15-5-4-6-16-28)29-30(32(37)39-19-9-13-26-11-7-17-34-21-26)24(2)36-25(3)31(29)33(38)40-20-10-14-27-12-8-18-35-22-27/h4-8,11-12,15-18,21-23,29,36H,9-10,13-14,19-20H2,1-3H3 |
| InChIKey | OOZFNDQEEIKMJW-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|