C38H41N3O4 — CID 11204210
bis(4-phenylbutyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 11204210) has the molecular formula C38H41N3O4 and a molecular weight of 603.76 g/mol. Its IUPAC name is bis(4-phenylbutyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(4-phenylbutyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11204210 |
| Molecular Formula | C38H41N3O4 |
| Molecular Weight | 603.76 g/mol |
| Exact Mass | 603.31 |
| IUPAC Name | bis(4-phenylbutyl) 2,6-dimethyl-4-(2-phenyl-1H-imidazol-5-yl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCCc2ccccc2)C(c2cnc(-c3ccccc3)[nH]2)C(C(=O)OCCCCc2ccccc2)=C(C)N1 |
| InChI | InChI=1S/C38H41N3O4/c1-27-33(37(42)44-24-14-12-20-29-16-6-3-7-17-29)35(32-26-39-36(41-32)31-22-10-5-11-23-31)34(28(2)40-27)38(43)45-25-15-13-21-30-18-8-4-9-19-30/h3-11,16-19,22-23,26,35,40H,12-15,20-21,24-25H2,1-2H3,(H,39,41) |
| InChIKey | UQTSTDLUXBXLFY-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.76 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|