C32H34N2O4 — CID 19834154
3-phenylpropyl 2,6-dimethyl-5-(methylcarbamoyl)-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 19834154) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is 3-phenylpropyl 2,6-dimethyl-5-(methylcarbamoyl)-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 3-phenylpropyl 2,6-dimethyl-5-(methylcarbamoyl)-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 19834154 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 3-phenylpropyl 2,6-dimethyl-5-(methylcarbamoyl)-4-(2-phenylmethoxyphenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CNC(=O)C1=C(C)NC(C)=C(C(=O)OCCCc2ccccc2)C1c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C32H34N2O4/c1-22-28(31(35)33-3)30(26-18-10-11-19-27(26)38-21-25-15-8-5-9-16-25)29(23(2)34-22)32(36)37-20-12-17-24-13-6-4-7-14-24/h4-11,13-16,18-19,30,34H,12,17,20-21H2,1-3H3,(H,33,35) |
| InChIKey | TVTDIDFHZOFQBJ-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|