C27H31Cl2NO3 — CID 54486898
3-phenylpropyl 4-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate (PubChem CID 54486898) has the molecular formula C27H31Cl2NO3 and a molecular weight of 488.46 g/mol. Its IUPAC name is 3-phenylpropyl 4-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate.
| Compound Name | 3-phenylpropyl 4-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 54486898 |
| Molecular Formula | C27H31Cl2NO3 |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | 3-phenylpropyl 4-(2,3-dichlorophenyl)-5-(3-methoxypropyl)-2,6-dimethyl-1,4-dihydropyridine-3-carboxylate |
| SMILES | COCCCC1=C(C)NC(C)=C(C(=O)OCCCc2ccccc2)C1c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C27H31Cl2NO3/c1-18-21(14-9-16-32-3)25(22-13-7-15-23(28)26(22)29)24(19(2)30-18)27(31)33-17-8-12-20-10-5-4-6-11-20/h4-7,10-11,13,15,25,30H,8-9,12,14,16-17H2,1-3H3 |
| InChIKey | XSYIHLBVLDAQJW-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|