C27H30Cl2N4O7 — CID 10100001
3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-(3-nitrooxypropyl) 2-amino-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10100001) has the molecular formula C27H30Cl2N4O7 and a molecular weight of 593.46 g/mol. Its IUPAC name is 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-(3-nitrooxypropyl) 2-amino-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-(3-nitrooxypropyl) 2-amino-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10100001 |
| Molecular Formula | C27H30Cl2N4O7 |
| Molecular Weight | 593.46 g/mol |
| Exact Mass | 592.15 |
| IUPAC Name | 3-O-[2-[benzyl(methyl)amino]ethyl] 5-O-(3-nitrooxypropyl) 2-amino-4-(2,3-dichlorophenyl)-6-methyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCCO[N+](=O)[O-])C(c2cccc(Cl)c2Cl)C(C(=O)OCCN(C)Cc2ccccc2)=C(N)N1 |
| InChI | InChI=1S/C27H30Cl2N4O7/c1-17-21(26(34)38-13-7-14-40-33(36)37)22(19-10-6-11-20(28)24(19)29)23(25(30)31-17)27(35)39-15-12-32(2)16-18-8-4-3-5-9-18/h3-6,8-11,22,31H,7,12-16,30H2,1-2H3 |
| InChIKey | INHNHJMUCJEQFZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 146.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|