C31H40ClN3O7 — CID 161224303
3-O-[2-[methyl-[(4-methylphenyl)methyl]amino]ethyl] 5-O-(2-propan-2-yloxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride (PubChem CID 161224303) has the molecular formula C31H40ClN3O7 and a molecular weight of 602.13 g/mol. Its IUPAC name is 3-O-[2-[methyl-[(4-methylphenyl)methyl]amino]ethyl] 5-O-(2-propan-2-yloxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride.
| Compound Name | 3-O-[2-[methyl-[(4-methylphenyl)methyl]amino]ethyl] 5-O-(2-propan-2-yloxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
|---|---|
| PubChem CID | 161224303 |
| Molecular Formula | C31H40ClN3O7 |
| Molecular Weight | 602.13 g/mol |
| Exact Mass | 601.26 |
| IUPAC Name | 3-O-[2-[methyl-[(4-methylphenyl)methyl]amino]ethyl] 5-O-(2-propan-2-yloxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate;hydrochloride |
| SMILES | CC1=C(C(=O)OCCOC(C)C)C(c2ccccc2[N+](=O)[O-])C(C(=O)OCCN(C)Cc2ccc(C)cc2)=C(C)N1.Cl |
| InChI | InChI=1S/C31H39N3O7.ClH/c1-20(2)39-17-18-41-31(36)28-23(5)32-22(4)27(29(28)25-9-7-8-10-26(25)34(37)38)30(35)40-16-15-33(6)19-24-13-11-21(3)12-14-24;/h7-14,20,29,32H,15-19H2,1-6H3;1H |
| InChIKey | UXXMWQAJLWSPTB-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 120.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.13 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|