C24H33N3O5 — CID 14676007
hexyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(propan-2-ylcarbamoyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 14676007) has the molecular formula C24H33N3O5 and a molecular weight of 443.54 g/mol. Its IUPAC name is hexyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(propan-2-ylcarbamoyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | hexyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(propan-2-ylcarbamoyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 14676007 |
| Molecular Formula | C24H33N3O5 |
| Molecular Weight | 443.54 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | hexyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(propan-2-ylcarbamoyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCCCCCOC(=O)C1=C(C)NC(C)=C(C(=O)NC(C)C)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H33N3O5/c1-6-7-8-11-14-32-24(29)21-17(5)26-16(4)20(23(28)25-15(2)3)22(21)18-12-9-10-13-19(18)27(30)31/h9-10,12-13,15,22,26H,6-8,11,14H2,1-5H3,(H,25,28) |
| InChIKey | AEDFZVLRZRWCHC-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.54 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|