C26H37N3O5 — CID 19844796
2,6-dimethyl-4-(2-nitrophenyl)-1-octyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid (PubChem CID 19844796) has the molecular formula C26H37N3O5 and a molecular weight of 471.60 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-nitrophenyl)-1-octyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 2,6-dimethyl-4-(2-nitrophenyl)-1-octyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19844796 |
| Molecular Formula | C26H37N3O5 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 2,6-dimethyl-4-(2-nitrophenyl)-1-octyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCCCCCCCN1C(C)=C(C(=O)O)C(c2ccccc2[N+](=O)[O-])C(C(=O)NC(C)C)=C1C |
| InChI | InChI=1S/C26H37N3O5/c1-6-7-8-9-10-13-16-28-18(4)22(25(30)27-17(2)3)24(23(19(28)5)26(31)32)20-14-11-12-15-21(20)29(33)34/h11-12,14-15,17,24H,6-10,13,16H2,1-5H3,(H,27,30)(H,31,32) |
| InChIKey | DWGCOUUYNWEHNA-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|