C27H39N3O5 — CID 19844801
2,6-dimethyl-4-(2-nitrophenyl)-1-nonyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid (PubChem CID 19844801) has the molecular formula C27H39N3O5 and a molecular weight of 485.63 g/mol. Its IUPAC name is 2,6-dimethyl-4-(2-nitrophenyl)-1-nonyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid.
| Compound Name | 2,6-dimethyl-4-(2-nitrophenyl)-1-nonyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 19844801 |
| Molecular Formula | C27H39N3O5 |
| Molecular Weight | 485.63 g/mol |
| Exact Mass | 485.29 |
| IUPAC Name | 2,6-dimethyl-4-(2-nitrophenyl)-1-nonyl-5-(propan-2-ylcarbamoyl)-4H-pyridine-3-carboxylic acid |
| SMILES | CCCCCCCCCN1C(C)=C(C(=O)O)C(c2ccccc2[N+](=O)[O-])C(C(=O)NC(C)C)=C1C |
| InChI | InChI=1S/C27H39N3O5/c1-6-7-8-9-10-11-14-17-29-19(4)23(26(31)28-18(2)3)25(24(20(29)5)27(32)33)21-15-12-13-16-22(21)30(34)35/h12-13,15-16,18,25H,6-11,14,17H2,1-5H3,(H,28,31)(H,32,33) |
| InChIKey | PGZOQBLFTHZJOM-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 112.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.63 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|