C23H29N3O7 — CID 70466753
methyl (4S)-5-[[(2S)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 70466753) has the molecular formula C23H29N3O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is methyl (4S)-5-[[(2S)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | methyl (4S)-5-[[(2S)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 70466753 |
| Molecular Formula | C23H29N3O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | methyl (4S)-5-[[(2S)-1-ethoxy-3-methyl-1-oxobutan-2-yl]carbamoyl]-2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | CCOC(=O)[C@@H](NC(=O)C1=C(C)NC(C)=C(C(=O)OC)[C@H]1c1ccccc1[N+](=O)[O-])C(C)C |
| InChI | InChI=1S/C23H29N3O7/c1-7-33-23(29)20(12(2)3)25-21(27)17-13(4)24-14(5)18(22(28)32-6)19(17)15-10-8-9-11-16(15)26(30)31/h8-12,19-20,24H,7H2,1-6H3,(H,25,27)/t19-,20-/m0/s1 |
| InChIKey | PNZZLGUOIWFJDM-PMACEKPBSA-N |
| XLogP | 2.71 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|