C17H17FN2O6 — CID 177410356
dimethyl 2-((18F)fluoromethyl)-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 177410356) has the molecular formula C17H17FN2O6 and a molecular weight of 363.33 g/mol. Its IUPAC name is dimethyl 2-((18F)fluoromethyl)-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2-((18F)fluoromethyl)-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 177410356 |
| Molecular Formula | C17H17FN2O6 |
| Molecular Weight | 363.33 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | dimethyl 2-((18F)fluoromethyl)-6-methyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C[18F])=C(C(=O)OC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H17FN2O6/c1-9-13(16(21)25-2)14(10-6-4-5-7-12(10)20(23)24)15(17(22)26-3)11(8-18)19-9/h4-7,14,19H,8H2,1-3H3/i18-1 |
| InChIKey | PHDVTYSHNBCDAM-SQZVAGKESA-N |
| XLogP | 2.13 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.33 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|