C18H19N3O9 — CID 10364866
3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 10364866) has the molecular formula C18H19N3O9 and a molecular weight of 421.36 g/mol. Its IUPAC name is 3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | 3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 10364866 |
| Molecular Formula | C18H19N3O9 |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-O-methyl 5-O-(2-nitrooxyethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OCCO[N+](=O)[O-])C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H19N3O9/c1-10-14(17(22)28-3)16(12-6-4-5-7-13(12)20(24)25)15(11(2)19-10)18(23)29-8-9-30-21(26)27/h4-7,16,19H,8-9H2,1-3H3 |
| InChIKey | HXCOUQWQYBUSDZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|