C29H28N4O6 — CID 23584963
bis(2-pyridin-2-ylethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 23584963) has the molecular formula C29H28N4O6 and a molecular weight of 528.57 g/mol. Its IUPAC name is bis(2-pyridin-2-ylethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(2-pyridin-2-ylethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 23584963 |
| Molecular Formula | C29H28N4O6 |
| Molecular Weight | 528.57 g/mol |
| Exact Mass | 528.20 |
| IUPAC Name | bis(2-pyridin-2-ylethyl) 2,6-dimethyl-4-(2-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OCCc2ccccn2)C(c2ccccc2[N+](=O)[O-])C(C(=O)OCCc2ccccn2)=C(C)N1 |
| InChI | InChI=1S/C29H28N4O6/c1-19-25(28(34)38-17-13-21-9-5-7-15-30-21)27(23-11-3-4-12-24(23)33(36)37)26(20(2)32-19)29(35)39-18-14-22-10-6-8-16-31-22/h3-12,15-16,27,32H,13-14,17-18H2,1-2H3 |
| InChIKey | OBQHALWPPVUBQV-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 133.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.57 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|