C26H33N3O5 — CID 14676016
octyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(prop-2-ynylcarbamoyl)-1,4-dihydropyridine-3-carboxylate (PubChem CID 14676016) has the molecular formula C26H33N3O5 and a molecular weight of 467.57 g/mol. Its IUPAC name is octyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(prop-2-ynylcarbamoyl)-1,4-dihydropyridine-3-carboxylate.
| Compound Name | octyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(prop-2-ynylcarbamoyl)-1,4-dihydropyridine-3-carboxylate |
|---|---|
| PubChem CID | 14676016 |
| Molecular Formula | C26H33N3O5 |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.24 |
| IUPAC Name | octyl 2,6-dimethyl-4-(2-nitrophenyl)-5-(prop-2-ynylcarbamoyl)-1,4-dihydropyridine-3-carboxylate |
| SMILES | C#CCNC(=O)C1=C(C)NC(C)=C(C(=O)OCCCCCCCC)C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H33N3O5/c1-5-7-8-9-10-13-17-34-26(31)23-19(4)28-18(3)22(25(30)27-16-6-2)24(23)20-14-11-12-15-21(20)29(32)33/h2,11-12,14-15,24,28H,5,7-10,13,16-17H2,1,3-4H3,(H,27,30) |
| InChIKey | IOERPRRZVMVESQ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|