C26H30N4O4 — CID 46245685
octyl 2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 46245685) has the molecular formula C26H30N4O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is octyl 2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | octyl 2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 46245685 |
| Molecular Formula | C26H30N4O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | octyl 2-methyl-4-(2-nitrophenyl)-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C)Nc2nc3ccccc3n2C1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H30N4O4/c1-3-4-5-6-7-12-17-34-25(31)23-18(2)27-26-28-20-14-9-11-16-22(20)29(26)24(23)19-13-8-10-15-21(19)30(32)33/h8-11,13-16,24H,3-7,12,17H2,1-2H3,(H,27,28) |
| InChIKey | NXNHXXSUYLQTFO-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|