C27H33N3O4 — CID 22425854
heptyl 4-(2,3-dimethoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 22425854) has the molecular formula C27H33N3O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is heptyl 4-(2,3-dimethoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | heptyl 4-(2,3-dimethoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 22425854 |
| Molecular Formula | C27H33N3O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.25 |
| IUPAC Name | heptyl 4-(2,3-dimethoxyphenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCCCOC(=O)C1=C(C)Nc2nc3ccccc3n2C1c1cccc(OC)c1OC |
| InChI | InChI=1S/C27H33N3O4/c1-5-6-7-8-11-17-34-26(31)23-18(2)28-27-29-20-14-9-10-15-21(20)30(27)24(23)19-13-12-16-22(32-3)25(19)33-4/h9-10,12-16,24H,5-8,11,17H2,1-4H3,(H,28,29) |
| InChIKey | WMQIQFIRUDCFBD-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|