C25H28ClN3O2 — CID 22425851
heptyl 4-(2-chlorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 22425851) has the molecular formula C25H28ClN3O2 and a molecular weight of 437.97 g/mol. Its IUPAC name is heptyl 4-(2-chlorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | heptyl 4-(2-chlorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 22425851 |
| Molecular Formula | C25H28ClN3O2 |
| Molecular Weight | 437.97 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | heptyl 4-(2-chlorophenyl)-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCCCOC(=O)C1=C(C)Nc2nc3ccccc3n2C1c1ccccc1Cl |
| InChI | InChI=1S/C25H28ClN3O2/c1-3-4-5-6-11-16-31-24(30)22-17(2)27-25-28-20-14-9-10-15-21(20)29(25)23(22)18-12-7-8-13-19(18)26/h7-10,12-15,23H,3-6,11,16H2,1-2H3,(H,27,28) |
| InChIKey | JANBXKXHEXURSZ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.97 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|