C26H28ClF2N3O3 — CID 98189223
heptyl (4S)-4-[5-chloro-2-(difluoromethoxy)phenyl]-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate (PubChem CID 98189223) has the molecular formula C26H28ClF2N3O3 and a molecular weight of 503.98 g/mol. Its IUPAC name is heptyl (4S)-4-[5-chloro-2-(difluoromethoxy)phenyl]-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate.
| Compound Name | heptyl (4S)-4-[5-chloro-2-(difluoromethoxy)phenyl]-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
|---|---|
| PubChem CID | 98189223 |
| Molecular Formula | C26H28ClF2N3O3 |
| Molecular Weight | 503.98 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | heptyl (4S)-4-[5-chloro-2-(difluoromethoxy)phenyl]-2-methyl-1,4-dihydropyrimido[1,2-a]benzimidazole-3-carboxylate |
| SMILES | CCCCCCCOC(=O)C1=C(C)Nc2nc3ccccc3n2[C@H]1c1cc(Cl)ccc1OC(F)F |
| InChI | InChI=1S/C26H28ClF2N3O3/c1-3-4-5-6-9-14-34-24(33)22-16(2)30-26-31-19-10-7-8-11-20(19)32(26)23(22)18-15-17(27)12-13-21(18)35-25(28)29/h7-8,10-13,15,23,25H,3-6,9,14H2,1-2H3,(H,30,31)/t23-/m0/s1 |
| InChIKey | OAPSHYQHBVNJDP-QHCPKHFHSA-N |
| XLogP | 7.09 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.98 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|