C22H31N5O4 — CID 136719849
octyl (7R)-7-(2,3-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136719849) has the molecular formula C22H31N5O4 and a molecular weight of 429.52 g/mol. Its IUPAC name is octyl (7R)-7-(2,3-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | octyl (7R)-7-(2,3-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136719849 |
| Molecular Formula | C22H31N5O4 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | octyl (7R)-7-(2,3-dimethoxyphenyl)-5-methyl-4,7-dihydrotetrazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C)Nc2nnnn2[C@@H]1c1cccc(OC)c1OC |
| InChI | InChI=1S/C22H31N5O4/c1-5-6-7-8-9-10-14-31-21(28)18-15(2)23-22-24-25-26-27(22)19(18)16-12-11-13-17(29-3)20(16)30-4/h11-13,19H,5-10,14H2,1-4H3,(H,23,24,26)/t19-/m1/s1 |
| InChIKey | ITZJIOCVPVVIGE-LJQANCHMSA-N |
| XLogP | 3.88 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|