C23H32N4O5 — CID 136719941
heptyl (7R)-5-methyl-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136719941) has the molecular formula C23H32N4O5 and a molecular weight of 444.53 g/mol. Its IUPAC name is heptyl (7R)-5-methyl-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | heptyl (7R)-5-methyl-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136719941 |
| Molecular Formula | C23H32N4O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.24 |
| IUPAC Name | heptyl (7R)-5-methyl-7-(2,3,4-trimethoxyphenyl)-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccc(OC)c(OC)c1OC |
| InChI | InChI=1S/C23H32N4O5/c1-6-7-8-9-10-13-32-22(28)18-15(2)26-23-24-14-25-27(23)19(18)16-11-12-17(29-3)21(31-5)20(16)30-4/h11-12,14,19H,6-10,13H2,1-5H3,(H,24,25,26)/t19-/m1/s1 |
| InChIKey | MJFQYDXAZBYEKD-LJQANCHMSA-N |
| XLogP | 4.11 |
| TPSA | 96.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|