C22H31N5O2 — CID 136719949
heptyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136719949) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is heptyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | heptyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136719949 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | heptyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C22H31N5O2/c1-5-6-7-8-9-14-29-21(28)19-16(2)25-22-23-15-24-27(22)20(19)17-10-12-18(13-11-17)26(3)4/h10-13,15,20H,5-9,14H2,1-4H3,(H,23,24,25)/t20-/m1/s1 |
| InChIKey | MWJZPYCLWCBDDO-HXUWFJFHSA-N |
| XLogP | 4.15 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|