C19H26N4O2S — CID 4139240
octyl 5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 4139240) has the molecular formula C19H26N4O2S and a molecular weight of 374.51 g/mol. Its IUPAC name is octyl 5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | octyl 5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 4139240 |
| Molecular Formula | C19H26N4O2S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | octyl 5-methyl-7-thiophen-2-yl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C)Nc2ncnn2C1c1cccs1 |
| InChI | InChI=1S/C19H26N4O2S/c1-3-4-5-6-7-8-11-25-18(24)16-14(2)22-19-20-13-21-23(19)17(16)15-10-9-12-26-15/h9-10,12-13,17H,3-8,11H2,1-2H3,(H,20,21,22) |
| InChIKey | WCGVUVUSJLRABH-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|