C23H33N5O2 — CID 136719921
octyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 136719921) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is octyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | octyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 136719921 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | octyl (7R)-7-[4-(dimethylamino)phenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCCCCOC(=O)C1=C(C)Nc2ncnn2[C@@H]1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C23H33N5O2/c1-5-6-7-8-9-10-15-30-22(29)20-17(2)26-23-24-16-25-28(23)21(20)18-11-13-19(14-12-18)27(3)4/h11-14,16,21H,5-10,15H2,1-4H3,(H,24,25,26)/t21-/m1/s1 |
| InChIKey | WLPAGCYFJUKPJF-OAQYLSRUSA-N |
| XLogP | 4.54 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|