C22H30N4O4 — CID 135825557
propyl 7-(3-methoxy-4-pentoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135825557) has the molecular formula C22H30N4O4 and a molecular weight of 414.51 g/mol. Its IUPAC name is propyl 7-(3-methoxy-4-pentoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | propyl 7-(3-methoxy-4-pentoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135825557 |
| Molecular Formula | C22H30N4O4 |
| Molecular Weight | 414.51 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | propyl 7-(3-methoxy-4-pentoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCCOc1ccc(C2C(C(=O)OCCC)=C(C)Nc3ncnn32)cc1OC |
| InChI | InChI=1S/C22H30N4O4/c1-5-7-8-12-29-17-10-9-16(13-18(17)28-4)20-19(21(27)30-11-6-2)15(3)25-22-23-14-24-26(20)22/h9-10,13-14,20H,5-8,11-12H2,1-4H3,(H,23,24,25) |
| InChIKey | DJKDDINKVIUKFD-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|