C25H26Cl2N4O4 — CID 135805655
butyl 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate (PubChem CID 135805655) has the molecular formula C25H26Cl2N4O4 and a molecular weight of 517.41 g/mol. Its IUPAC name is butyl 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate.
| Compound Name | butyl 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
|---|---|
| PubChem CID | 135805655 |
| Molecular Formula | C25H26Cl2N4O4 |
| Molecular Weight | 517.41 g/mol |
| Exact Mass | 516.13 |
| IUPAC Name | butyl 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)Nc2ncnn2C1c1ccc(OCc2c(Cl)cccc2Cl)c(OC)c1 |
| InChI | InChI=1S/C25H26Cl2N4O4/c1-4-5-11-34-24(32)22-15(2)30-25-28-14-29-31(25)23(22)16-9-10-20(21(12-16)33-3)35-13-17-18(26)7-6-8-19(17)27/h6-10,12,14,23H,4-5,11,13H2,1-3H3,(H,28,29,30) |
| InChIKey | ZDXABEKNDSEIJH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 87.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.41 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|