C28H25Cl2N5O4 — CID 135579504
7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide (PubChem CID 135579504) has the molecular formula C28H25Cl2N5O4 and a molecular weight of 566.45 g/mol. Its IUPAC name is 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide.
| Compound Name | 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 135579504 |
| Molecular Formula | C28H25Cl2N5O4 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | 7-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]-N-(4-methoxyphenyl)-5-methyl-4,7-dihydro-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxamide |
| SMILES | COc1ccc(NC(=O)C2=C(C)Nc3ncnn3C2c2ccc(OCc3c(Cl)cccc3Cl)c(OC)c2)cc1 |
| InChI | InChI=1S/C28H25Cl2N5O4/c1-16-25(27(36)34-18-8-10-19(37-2)11-9-18)26(35-28(33-16)31-15-32-35)17-7-12-23(24(13-17)38-3)39-14-20-21(29)5-4-6-22(20)30/h4-13,15,26H,14H2,1-3H3,(H,34,36)(H,31,32,33) |
| InChIKey | UBFWNEPSBBJQAR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 99.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |